C10H6ClIN2O2S — CID 171095803
methyl 3-(3-chloro-2-pyridinyl)-4-iodo-1,2-thiazole-5-carboxylate (PubChem CID 171095803) has the molecular formula C10H6ClIN2O2S and a molecular weight of 380.59 g/mol. Its IUPAC name is methyl 3-(3-chloro-2-pyridinyl)-4-iodo-1,2-thiazole-5-carboxylate.
| Compound Name | methyl 3-(3-chloro-2-pyridinyl)-4-iodo-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 171095803 |
| Molecular Formula | C10H6ClIN2O2S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | methyl 3-(3-chloro-2-pyridinyl)-4-iodo-1,2-thiazole-5-carboxylate |
| SMILES | COC(=O)c1snc(-c2ncccc2Cl)c1I |
| InChI | InChI=1S/C10H6ClIN2O2S/c1-16-10(15)9-6(12)8(14-17-9)7-5(11)3-2-4-13-7/h2-4H,1H3 |
| InChIKey | SJAQEEBPNSUAGT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|