C20H15BrN2O4S — CID 17109790
5-(4-bromophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)furan-2-carboxamide (PubChem CID 17109790) has the molecular formula C20H15BrN2O4S and a molecular weight of 459.32 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)furan-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17109790 |
| Molecular Formula | C20H15BrN2O4S |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 5-(4-bromophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2c(c1)OCCO2)c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C20H15BrN2O4S/c21-13-3-1-12(2-4-13)15-7-8-17(27-15)19(24)23-20(28)22-14-5-6-16-18(11-14)26-10-9-25-16/h1-8,11H,9-10H2,(H2,22,23,24,28) |
| InChIKey | ZXXRJDNRIQKNEF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|