C28H22ClN3O2Si — CID 171098995
7-[5-(4-chlorophenyl)-2-phenyl-1,3-oxazol-4-yl]-5-(2-trimethylsilylethynyl)-1,7-naphthyridin-8-one (PubChem CID 171098995) has the molecular formula C28H22ClN3O2Si and a molecular weight of 496.04 g/mol. Its IUPAC name is 7-[5-(4-chlorophenyl)-2-phenyl-1,3-oxazol-4-yl]-5-(2-trimethylsilylethynyl)-1,7-naphthyridin-8-one.
| Compound Name | 7-[5-(4-chlorophenyl)-2-phenyl-1,3-oxazol-4-yl]-5-(2-trimethylsilylethynyl)-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 171098995 |
| Molecular Formula | C28H22ClN3O2Si |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 7-[5-(4-chlorophenyl)-2-phenyl-1,3-oxazol-4-yl]-5-(2-trimethylsilylethynyl)-1,7-naphthyridin-8-one |
| SMILES | C[Si](C)(C)C#Cc1cn(-c2nc(-c3ccccc3)oc2-c2ccc(Cl)cc2)c(=O)c2ncccc12 |
| InChI | InChI=1S/C28H22ClN3O2Si/c1-35(2,3)17-15-21-18-32(28(33)24-23(21)10-7-16-30-24)26-25(19-11-13-22(29)14-12-19)34-27(31-26)20-8-5-4-6-9-20/h4-14,16,18H,1-3H3 |
| InChIKey | JXSMQWHEYUODGE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|