C26H20N4O2 — CID 3297198
4-anilino-1-(2,5-diphenyl-1,3-oxazol-4-yl)-5-methylpyrimidin-2-one (PubChem CID 3297198) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-anilino-1-(2,5-diphenyl-1,3-oxazol-4-yl)-5-methylpyrimidin-2-one.
| Compound Name | 4-anilino-1-(2,5-diphenyl-1,3-oxazol-4-yl)-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 3297198 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-anilino-1-(2,5-diphenyl-1,3-oxazol-4-yl)-5-methylpyrimidin-2-one |
| SMILES | Cc1cn(-c2nc(-c3ccccc3)oc2-c2ccccc2)c(=O)nc1Nc1ccccc1 |
| InChI | InChI=1S/C26H20N4O2/c1-18-17-30(26(31)28-23(18)27-21-15-9-4-10-16-21)24-22(19-11-5-2-6-12-19)32-25(29-24)20-13-7-3-8-14-20/h2-17H,1H3,(H,27,28,31) |
| InChIKey | VDTLRJXQSBPBCS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |