C16H21F3N4O2 — CID 171099994
1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-propoxyethanone (PubChem CID 171099994) has the molecular formula C16H21F3N4O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-propoxyethanone.
| Compound Name | 1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-propoxyethanone |
|---|---|
| PubChem CID | 171099994 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-propoxyethanone |
| SMILES | CCCOCC(=O)N1CC[C@@H]2[C@H]1CCN2c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H21F3N4O2/c1-2-7-25-10-14(24)22-5-3-13-12(22)4-6-23(13)15-20-8-11(9-21-15)16(17,18)19/h8-9,12-13H,2-7,10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | HZEFFRSKLVJGCT-CHWSQXEVSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|