About N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane
N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane (PubChem CID 171106670) has the molecular formula C19H21N3
and a molecular weight of 291.40 g/mol. Its IUPAC name is N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane.
Molecular Properties
| Compound Name | N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane |
| PubChem CID | 171106670 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane |
| SMILES | C=Cc1ccc(Nc2ccc3[nH]ccc3c2)nc1C=C.CC |
| InChI | InChI=1S/C17H15N3.C2H6/c1-3-12-5-8-17(20-15(12)4-2)19-14-6-7-16-13(11-14)9-10-18-16;1-2/h3-11,18H,1-2H2,(H,19,20);1-2H3 |
| InChIKey | PZEPQXCAWUOIED-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane?
The IUPAC name of N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane (CID 171106670) is N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane.
What is the SMILES notation for N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane?
The canonical SMILES for N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane is C=Cc1ccc(Nc2ccc3[nH]ccc3c2)nc1C=C.CC.
What is the InChIKey of N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane?
The InChIKey is PZEPQXCAWUOIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3.C2H6/c1-3-12-5-8-17(20-15(12)4-2)19-14-6-7-16-13(11-14)9-10-18-16;1-2/h3-11,18H,1-2H2,(H,19,20);1-2H3.
What are the key properties of N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane?
N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane has a molecular weight of 291.40 g/mol, XLogP of 5.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5,6-bis(ethenyl)-2-pyridinyl]-1H-indol-5-amine;ethane is sourced from PubChem (CID 171106670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).