C22H36ClNO — CID 171109278
4-[5-tert-butyl-2-(cyclohexylmethoxy)phenyl]piperidine;hydrochloride (PubChem CID 171109278) has the molecular formula C22H36ClNO and a molecular weight of 365.99 g/mol. Its IUPAC name is 4-[5-tert-butyl-2-(cyclohexylmethoxy)phenyl]piperidine;hydrochloride.
| Compound Name | 4-[5-tert-butyl-2-(cyclohexylmethoxy)phenyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 171109278 |
| Molecular Formula | C22H36ClNO |
| Molecular Weight | 365.99 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 4-[5-tert-butyl-2-(cyclohexylmethoxy)phenyl]piperidine;hydrochloride |
| SMILES | CC(C)(C)c1ccc(OCC2CCCCC2)c(C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C22H35NO.ClH/c1-22(2,3)19-9-10-21(24-16-17-7-5-4-6-8-17)20(15-19)18-11-13-23-14-12-18;/h9-10,15,17-18,23H,4-8,11-14,16H2,1-3H3;1H |
| InChIKey | PZTHRSCGHLMYIX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.99 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |