C15H28BFO2 — CID 171110432
2-(1-fluoro-3,3-dimethylhept-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110432) has the molecular formula C15H28BFO2 and a molecular weight of 270.20 g/mol. Its IUPAC name is 2-(1-fluoro-3,3-dimethylhept-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-fluoro-3,3-dimethylhept-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110432 |
| Molecular Formula | C15H28BFO2 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-(1-fluoro-3,3-dimethylhept-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCC(C)(C)C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H28BFO2/c1-8-9-10-13(2,3)11-12(17)16-18-14(4,5)15(6,7)19-16/h11H,8-10H2,1-7H3 |
| InChIKey | XAOIWVQFYZHYNH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|