C19H24BFN2O2 — CID 171112749
2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1-methylpyrrolo[2,3-b]pyridine (PubChem CID 171112749) has the molecular formula C19H24BFN2O2 and a molecular weight of 342.22 g/mol. Its IUPAC name is 2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 171112749 |
| Molecular Formula | C19H24BFN2O2 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-1-methylpyrrolo[2,3-b]pyridine |
| SMILES | Cn1c(C2CC(=C(F)B3OC(C)(C)C(C)(C)O3)C2)cc2cccnc21 |
| InChI | InChI=1S/C19H24BFN2O2/c1-18(2)19(3,4)25-20(24-18)16(21)14-9-13(10-14)15-11-12-7-6-8-22-17(12)23(15)5/h6-8,11,13H,9-10H2,1-5H3/b16-14- |
| InChIKey | NNJKQZSCIFPBNJ-PEZBUJJGSA-N |
| XLogP | 4.31 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|