C45H68O — CID 171118831
(E)-4-[5-[(3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-3,5,7,9,11,13,15,19,23-nonaenyl]-4,6,6-trimethylcyclohex-3-en-1-yl]-2-methylbut-2-en-1-ol (PubChem CID 171118831) has the molecular formula C45H68O and a molecular weight of 625.04 g/mol. Its IUPAC name is (E)-4-[5-[(3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-3,5,7,9,11,13,15,19,23-nonaenyl]-4,6,6-trimethylcyclohex-3-en-1-yl]-2-methylbut-2-en-1-ol.
| Compound Name | (E)-4-[5-[(3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-3,5,7,9,11,13,15,19,23-nonaenyl]-4,6,6-trimethylcyclohex-3-en-1-yl]-2-methylbut-2-en-1-ol |
|---|---|
| PubChem CID | 171118831 |
| Molecular Formula | C45H68O |
| Molecular Weight | 625.04 g/mol |
| Exact Mass | 624.53 |
| IUPAC Name | (E)-4-[5-[(3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-3,5,7,9,11,13,15,19,23-nonaenyl]-4,6,6-trimethylcyclohex-3-en-1-yl]-2-methylbut-2-en-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CCC1C(C)=CCC(C/C=C(\C)CO)C1(C)C |
| InChI | InChI=1S/C45H68O/c1-35(2)18-14-21-38(5)24-16-26-39(6)25-15-22-36(3)19-12-13-20-37(4)23-17-27-40(7)29-33-44-42(9)30-32-43(45(44,10)11)31-28-41(8)34-46/h12-13,15,17-20,22-25,27-28,30,43-44,46H,14,16,21,26,29,31-34H2,1-11H3/b13-12+,22-15+,23-17+,36-19+,37-20+,38-24+,39-25+,40-27+,41-28+ |
| InChIKey | DWFSIGAGLBDXKW-HHYHVSHPSA-N |
| XLogP | 13.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.04 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|