C18H12BrFN2O4S — CID 171129120
[2-bromo-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate (PubChem CID 171129120) has the molecular formula C18H12BrFN2O4S and a molecular weight of 451.27 g/mol. Its IUPAC name is [2-bromo-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [2-bromo-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 171129120 |
| Molecular Formula | C18H12BrFN2O4S |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | [2-bromo-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2cc(Br)c(OC(=O)c3ccc(F)cc3)c(OC)c2)S1 |
| InChI | InChI=1S/C18H12BrFN2O4S/c1-25-13-7-9(8-14-16(23)22-18(21)27-14)6-12(19)15(13)26-17(24)10-2-4-11(20)5-3-10/h2-8H,1H3,(H2,21,22,23) |
| InChIKey | VJOAJEATXCVZOJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|