C20H17BrN2O5S — CID 154792556
[2-bromo-6-ethoxy-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methoxybenzoate (PubChem CID 154792556) has the molecular formula C20H17BrN2O5S and a molecular weight of 477.34 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2-bromo-6-ethoxy-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 154792556 |
| Molecular Formula | C20H17BrN2O5S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methoxybenzoate |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2cc(Br)c(OC(=O)c3cccc(OC)c3)c(OCC)c2)S1 |
| InChI | InChI=1S/C20H17BrN2O5S/c1-3-27-15-8-11(9-16-18(24)23-20(22)29-16)7-14(21)17(15)28-19(25)12-5-4-6-13(10-12)26-2/h4-10H,3H2,1-2H3,(H2,22,23,24)/b16-9- |
| InChIKey | OCESBYSVMWWZEG-SXGWCWSVSA-N |
| XLogP | 4.21 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|