C13H8FN3O3S — CID 171130740
N-[(5-fluorothiophen-2-yl)methylideneamino]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 171130740) has the molecular formula C13H8FN3O3S and a molecular weight of 305.29 g/mol. Its IUPAC name is N-[(5-fluorothiophen-2-yl)methylideneamino]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(5-fluorothiophen-2-yl)methylideneamino]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 171130740 |
| Molecular Formula | C13H8FN3O3S |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-[(5-fluorothiophen-2-yl)methylideneamino]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc(F)s1)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C13H8FN3O3S/c14-12-4-3-8(21-12)7-15-16-13(18)9-6-11(20-17-9)10-2-1-5-19-10/h1-7H,(H,16,18) |
| InChIKey | AQHMLTWQRXHDNR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|