C15H10FN3O3S — CID 137030919
N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 137030919) has the molecular formula C15H10FN3O3S and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 137030919 |
| Molecular Formula | C15H10FN3O3S |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(F)s1)c1cc(-c2ccc(O)cc2)on1 |
| InChI | InChI=1S/C15H10FN3O3S/c16-14-6-5-11(23-14)8-17-18-15(21)12-7-13(22-19-12)9-1-3-10(20)4-2-9/h1-8,20H,(H,18,21)/b17-8- |
| InChIKey | PBPXCOVAXCOYIL-IUXPMGMMSA-N |
| XLogP | 3.01 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|