C19H17FN2O3S — CID 171130863
5-[(2,3-dimethylphenoxy)methyl]-N-[(5-fluorothiophen-2-yl)methylideneamino]furan-2-carboxamide (PubChem CID 171130863) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 5-[(2,3-dimethylphenoxy)methyl]-N-[(5-fluorothiophen-2-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(2,3-dimethylphenoxy)methyl]-N-[(5-fluorothiophen-2-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 171130863 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 5-[(2,3-dimethylphenoxy)methyl]-N-[(5-fluorothiophen-2-yl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1cccc(OCc2ccc(C(=O)NN=Cc3ccc(F)s3)o2)c1C |
| InChI | InChI=1S/C19H17FN2O3S/c1-12-4-3-5-16(13(12)2)24-11-14-6-8-17(25-14)19(23)22-21-10-15-7-9-18(20)26-15/h3-10H,11H2,1-2H3,(H,22,23) |
| InChIKey | CUDKMHFFHKTLNU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|