C22H18N2O5 — CID 171133916
N-[5-(5-carbamoylfuran-2-yl)-2-methylphenyl]-3-methoxy-1-benzofuran-2-carboxamide (PubChem CID 171133916) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[5-(5-carbamoylfuran-2-yl)-2-methylphenyl]-3-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-(5-carbamoylfuran-2-yl)-2-methylphenyl]-3-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 171133916 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[5-(5-carbamoylfuran-2-yl)-2-methylphenyl]-3-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2cc(-c3ccc(C(N)=O)o3)ccc2C)oc2ccccc12 |
| InChI | InChI=1S/C22H18N2O5/c1-12-7-8-13(16-9-10-18(28-16)21(23)25)11-15(12)24-22(26)20-19(27-2)14-5-3-4-6-17(14)29-20/h3-11H,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | JIGSEAGHUTXPPH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |