C18H20N2O — CID 171134567
N,5,6-trimethyl-N-(3-phenylprop-2-enyl)pyridine-3-carboxamide (PubChem CID 171134567) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N,5,6-trimethyl-N-(3-phenylprop-2-enyl)pyridine-3-carboxamide.
| Compound Name | N,5,6-trimethyl-N-(3-phenylprop-2-enyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171134567 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N,5,6-trimethyl-N-(3-phenylprop-2-enyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)CC=Cc2ccccc2)cnc1C |
| InChI | InChI=1S/C18H20N2O/c1-14-12-17(13-19-15(14)2)18(21)20(3)11-7-10-16-8-5-4-6-9-16/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | OXWLNNDDJMOPOY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |