C22H20FNO6S — CID 171136496
methyl 2-(4-fluorophenyl)imino-4-hydroxy-5-[(2,3,4-trimethoxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 171136496) has the molecular formula C22H20FNO6S and a molecular weight of 445.47 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)imino-4-hydroxy-5-[(2,3,4-trimethoxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | methyl 2-(4-fluorophenyl)imino-4-hydroxy-5-[(2,3,4-trimethoxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136496 |
| Molecular Formula | C22H20FNO6S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | methyl 2-(4-fluorophenyl)imino-4-hydroxy-5-[(2,3,4-trimethoxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccc(OC)c(OC)c2OC)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C22H20FNO6S/c1-27-15-10-5-12(19(28-2)20(15)29-3)11-16-18(25)17(22(26)30-4)21(31-16)24-14-8-6-13(23)7-9-14/h5-11,25H,1-4H3/b16-11?,24-21- |
| InChIKey | SZMRIEIWFGKYIH-HILUADHDSA-N |
| XLogP | 4.65 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|