C17H12FNO4S — CID 135503354
methyl 2-(4-fluorophenyl)imino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate (PubChem CID 135503354) has the molecular formula C17H12FNO4S and a molecular weight of 345.35 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)imino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate.
| Compound Name | methyl 2-(4-fluorophenyl)imino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135503354 |
| Molecular Formula | C17H12FNO4S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | methyl 2-(4-fluorophenyl)imino-5-(furan-2-ylmethylidene)-4-hydroxythiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccco2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12FNO4S/c1-22-17(21)14-15(20)13(9-12-3-2-8-23-12)24-16(14)19-11-6-4-10(18)5-7-11/h2-9,20H,1H3/b13-9?,19-16- |
| InChIKey | JXGFBKDZUSWIFK-ZEBZVXQVSA-N |
| XLogP | 4.22 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|