C19H14FNO5S — CID 171136093
methyl 5-[(2,5-dihydroxyphenyl)methylidene]-2-(4-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate (PubChem CID 171136093) has the molecular formula C19H14FNO5S and a molecular weight of 387.39 g/mol. Its IUPAC name is methyl 5-[(2,5-dihydroxyphenyl)methylidene]-2-(4-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate.
| Compound Name | methyl 5-[(2,5-dihydroxyphenyl)methylidene]-2-(4-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136093 |
| Molecular Formula | C19H14FNO5S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | methyl 5-[(2,5-dihydroxyphenyl)methylidene]-2-(4-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2cc(O)ccc2O)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FNO5S/c1-26-19(25)16-17(24)15(9-10-8-13(22)6-7-14(10)23)27-18(16)21-12-4-2-11(20)3-5-12/h2-9,22-24H,1H3/b15-9?,21-18- |
| InChIKey | HVRXWJFMHPCUCY-HAAOTLMFSA-N |
| XLogP | 4.04 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|