C18H13FN2O3S — CID 135939921
methyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate (PubChem CID 135939921) has the molecular formula C18H13FN2O3S and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate.
| Compound Name | methyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135939921 |
| Molecular Formula | C18H13FN2O3S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | methyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)/C(=C\c2ccccn2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13FN2O3S/c1-24-18(23)15-16(22)14(10-13-4-2-3-9-20-13)25-17(15)21-12-7-5-11(19)6-8-12/h2-10,22H,1H3/b14-10+,21-17- |
| InChIKey | ZFKNZDNZLCTCBN-GGYOASSPSA-N |
| XLogP | 4.02 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|