C9H16N2O4S — CID 171137854
4-hydroxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2-thione (PubChem CID 171137854) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-hydroxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2-thione.
| Compound Name | 4-hydroxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 171137854 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-hydroxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2-thione |
| SMILES | OC[C@H]1O[C@@H](N2CCC(O)NC2=S)C[C@@H]1O |
| InChI | InChI=1S/C9H16N2O4S/c12-4-6-5(13)3-8(15-6)11-2-1-7(14)10-9(11)16/h5-8,12-14H,1-4H2,(H,10,16)/t5-,6+,7?,8+/m0/s1 |
| InChIKey | IUGSMLYHKJCGJG-CZLDRYSHSA-N |
| XLogP | -1.65 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|