C17H22ClFN2O2 — CID 171142774
1-[5-[(2-chloro-6-fluorophenyl)methyl]-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]ethanone (PubChem CID 171142774) has the molecular formula C17H22ClFN2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is 1-[5-[(2-chloro-6-fluorophenyl)methyl]-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]ethanone.
| Compound Name | 1-[5-[(2-chloro-6-fluorophenyl)methyl]-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 171142774 |
| Molecular Formula | C17H22ClFN2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[5-[(2-chloro-6-fluorophenyl)methyl]-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]ethanone |
| SMILES | CC(=O)N1CC2CCN(Cc3c(F)cccc3Cl)CC2(CO)C1 |
| InChI | InChI=1S/C17H22ClFN2O2/c1-12(23)21-7-13-5-6-20(9-17(13,10-21)11-22)8-14-15(18)3-2-4-16(14)19/h2-4,13,22H,5-11H2,1H3 |
| InChIKey | DDNHKVPAKAMVFH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |