C24H37FN4O2 — CID 171143845
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methyl-1-(2-methylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 171143845) has the molecular formula C24H37FN4O2 and a molecular weight of 432.58 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methyl-1-(2-methylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methyl-1-(2-methylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 171143845 |
| Molecular Formula | C24H37FN4O2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methyl-1-(2-methylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CC(C)CN1C(=O)CCC(C(=O)NCCCN2CCN(c3ccc(F)cc3)CC2)C1C |
| InChI | InChI=1S/C24H37FN4O2/c1-18(2)17-29-19(3)22(9-10-23(29)30)24(31)26-11-4-12-27-13-15-28(16-14-27)21-7-5-20(25)6-8-21/h5-8,18-19,22H,4,9-17H2,1-3H3,(H,26,31) |
| InChIKey | RAEXVFPHRFKRSB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|