C14H15BrClIN2O2S — CID 171151014
5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 171151014) has the molecular formula C14H15BrClIN2O2S and a molecular weight of 517.61 g/mol. Its IUPAC name is 5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | 5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 171151014 |
| Molecular Formula | C14H15BrClIN2O2S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 515.88 |
| IUPAC Name | 5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CC/N=C1/SC(=Cc2cc(Br)cc(I)c2O)C(=O)N1CC.Cl |
| InChI | InChI=1S/C14H14BrIN2O2S.ClH/c1-3-17-14-18(4-2)13(20)11(21-14)6-8-5-9(15)7-10(16)12(8)19;/h5-7,19H,3-4H2,1-2H3;1H/b11-6?,17-14+; |
| InChIKey | HADYNBHGYHVWRW-WNSFNTEFSA-N |
| XLogP | 4.49 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|