C23H28N4O2S — CID 171152713
6-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 171152713) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 6-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171152713 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6-[(2S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carbonyl]-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(C(=O)N2CCCC3=CC4CC(CN5CCCC[C@H]45)[C@@H]32)sc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C23H28N4O2S/c1-13-18-21(28)24-12-25-22(18)30-20(13)23(29)27-8-4-5-14-9-15-10-16(19(14)27)11-26-7-3-2-6-17(15)26/h9,12,15-17,19H,2-8,10-11H2,1H3,(H,24,25,28)/t15?,16?,17-,19-/m1/s1 |
| InChIKey | LPPMVEHGZWXTBA-HTPOPCQBSA-N |
| XLogP | 3.33 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|