C23H34N4O — CID 124939393
[(1R,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[5-(2-methylpropyl)-1H-pyrazol-3-yl]methanone (PubChem CID 124939393) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is [(1R,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[5-(2-methylpropyl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [(1R,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[5-(2-methylpropyl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 124939393 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [(1R,2R,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-[5-(2-methylpropyl)-1H-pyrazol-3-yl]methanone |
| SMILES | CC(C)Cc1cc(C(=O)N2CCCC3=C[C@H]4C[C@H](CN5CCCC[C@H]45)[C@H]32)n[nH]1 |
| InChI | InChI=1S/C23H34N4O/c1-15(2)10-19-13-20(25-24-19)23(28)27-9-5-6-16-11-17-12-18(22(16)27)14-26-8-4-3-7-21(17)26/h11,13,15,17-18,21-22H,3-10,12,14H2,1-2H3,(H,24,25)/t17-,18+,21+,22-/m0/s1 |
| InChIKey | WDALTMWEEOLIFO-KKXYHZGYSA-N |
| XLogP | 3.64 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|