C21H21N3O5 — CID 171152991
11-[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 171152991) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 11-[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 171152991 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 11-[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C(Cc1ccc2c(c1)CCO2)N1CC2CC(C1)c1ccc([N+](=O)[O-])c(=O)n1C2 |
| InChI | InChI=1S/C21H21N3O5/c25-20(9-13-1-4-19-15(7-13)5-6-29-19)22-10-14-8-16(12-22)17-2-3-18(24(27)28)21(26)23(17)11-14/h1-4,7,14,16H,5-6,8-12H2 |
| InChIKey | SOGJYRSOZJWVRJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|