C18H25FN4O4S — CID 171155707
N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-7-(methanesulfonamido)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]acetamide (PubChem CID 171155707) has the molecular formula C18H25FN4O4S and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-7-(methanesulfonamido)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]acetamide.
| Compound Name | N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-7-(methanesulfonamido)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 171155707 |
| Molecular Formula | C18H25FN4O4S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-7-(methanesulfonamido)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1C(=O)N2C[C@@H](NS(C)(=O)=O)C[C@H]2CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN4O4S/c1-12(24)20-8-17-18(25)23-10-15(21-28(2,26)27)7-16(23)11-22(17)9-13-3-5-14(19)6-4-13/h3-6,15-17,21H,7-11H2,1-2H3,(H,20,24)/t15-,16-,17-/m0/s1 |
| InChIKey | UZPGJCGQNRRJPA-ULQDDVLXSA-N |
| XLogP | -0.34 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |