C9H19ClN2O3S — CID 171158832
N-(1,3,3a,4,5,6,7,7a-octahydrofuro[3,4-c]pyridin-1-ylmethyl)methanesulfonamide;hydrochloride (PubChem CID 171158832) has the molecular formula C9H19ClN2O3S and a molecular weight of 270.78 g/mol. Its IUPAC name is N-(1,3,3a,4,5,6,7,7a-octahydrofuro[3,4-c]pyridin-1-ylmethyl)methanesulfonamide;hydrochloride.
| Compound Name | N-(1,3,3a,4,5,6,7,7a-octahydrofuro[3,4-c]pyridin-1-ylmethyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 171158832 |
| Molecular Formula | C9H19ClN2O3S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(1,3,3a,4,5,6,7,7a-octahydrofuro[3,4-c]pyridin-1-ylmethyl)methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NCC1OCC2CNCCC21.Cl |
| InChI | InChI=1S/C9H18N2O3S.ClH/c1-15(12,13)11-5-9-8-2-3-10-4-7(8)6-14-9;/h7-11H,2-6H2,1H3;1H |
| InChIKey | ONMQSKSJTMLEHK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |