C13H18BCl2NO3 — CID 171191267
2-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,6-dichlorophenol (PubChem CID 171191267) has the molecular formula C13H18BCl2NO3 and a molecular weight of 318.01 g/mol. Its IUPAC name is 2-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,6-dichlorophenol.
| Compound Name | 2-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 171191267 |
| Molecular Formula | C13H18BCl2NO3 |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,6-dichlorophenol |
| SMILES | CC1(C)OB([C@H](N)c2cc(Cl)cc(Cl)c2O)OC1(C)C |
| InChI | InChI=1S/C13H18BCl2NO3/c1-12(2)13(3,4)20-14(19-12)11(17)8-5-7(15)6-9(16)10(8)18/h5-6,11,18H,17H2,1-4H3/t11-/m1/s1 |
| InChIKey | QWUZGWWCNNJBHR-LLVKDONJSA-N |
| XLogP | 3.33 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|