C10H17BrNO3PS — CID 171191732
(S)-(5-bromo-4-methylthiophen-2-yl)-diethoxyphosphorylmethanamine (PubChem CID 171191732) has the molecular formula C10H17BrNO3PS and a molecular weight of 342.20 g/mol. Its IUPAC name is (S)-(5-bromo-4-methylthiophen-2-yl)-diethoxyphosphorylmethanamine.
| Compound Name | (S)-(5-bromo-4-methylthiophen-2-yl)-diethoxyphosphorylmethanamine |
|---|---|
| PubChem CID | 171191732 |
| Molecular Formula | C10H17BrNO3PS |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | (S)-(5-bromo-4-methylthiophen-2-yl)-diethoxyphosphorylmethanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C10H17BrNO3PS/c1-4-14-16(13,15-5-2)10(12)8-6-7(3)9(11)17-8/h6,10H,4-5,12H2,1-3H3/t10-/m0/s1 |
| InChIKey | VXCUMLDNSFHBTH-JTQLQIEISA-N |
| XLogP | 4.04 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|