C14H18ClNO2 — CID 171201678
6-[(1R)-1-amino-4-hydroxybutyl]naphthalen-2-ol;hydrochloride (PubChem CID 171201678) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-[(1R)-1-amino-4-hydroxybutyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 6-[(1R)-1-amino-4-hydroxybutyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171201678 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-[(1R)-1-amino-4-hydroxybutyl]naphthalen-2-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCCO)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C14H17NO2.ClH/c15-14(2-1-7-16)12-4-3-11-9-13(17)6-5-10(11)8-12;/h3-6,8-9,14,16-17H,1-2,7,15H2;1H/t14-;/m1./s1 |
| InChIKey | RZTJHEVYCWVTOC-PFEQFJNWSA-N |
| XLogP | 2.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |