C14H20ClNO3 — CID 171211702
5-[(R)-amino(cyclohexyl)methyl]-2-hydroxybenzoic acid;hydrochloride (PubChem CID 171211702) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 5-[(R)-amino(cyclohexyl)methyl]-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 5-[(R)-amino(cyclohexyl)methyl]-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171211702 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-[(R)-amino(cyclohexyl)methyl]-2-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(O)c(C(=O)O)c1)C1CCCCC1 |
| InChI | InChI=1S/C14H19NO3.ClH/c15-13(9-4-2-1-3-5-9)10-6-7-12(16)11(8-10)14(17)18;/h6-9,13,16H,1-5,15H2,(H,17,18);1H/t13-;/m1./s1 |
| InChIKey | VYRZUANLQZIUSN-BTQNPOSSSA-N |
| XLogP | 3.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |