C13H17Br2N3 — CID 171273514
2,4-dibromo-6-[(1S)-1-piperazin-1-ylprop-2-enyl]aniline (PubChem CID 171273514) has the molecular formula C13H17Br2N3 and a molecular weight of 375.11 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1S)-1-piperazin-1-ylprop-2-enyl]aniline.
| Compound Name | 2,4-dibromo-6-[(1S)-1-piperazin-1-ylprop-2-enyl]aniline |
|---|---|
| PubChem CID | 171273514 |
| Molecular Formula | C13H17Br2N3 |
| Molecular Weight | 375.11 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2,4-dibromo-6-[(1S)-1-piperazin-1-ylprop-2-enyl]aniline |
| SMILES | C=C[C@@H](c1cc(Br)cc(Br)c1N)N1CCNCC1 |
| InChI | InChI=1S/C13H17Br2N3/c1-2-12(18-5-3-17-4-6-18)10-7-9(14)8-11(15)13(10)16/h2,7-8,12,17H,1,3-6,16H2/t12-/m0/s1 |
| InChIKey | DGQFJCRDCGDVPP-LBPRGKRZSA-N |
| XLogP | 2.93 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|