C13H21ClN2O — CID 171282491
1-[(1S)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]piperazine (PubChem CID 171282491) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]piperazine.
| Compound Name | 1-[(1S)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]piperazine |
|---|---|
| PubChem CID | 171282491 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-[(1S)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]piperazine |
| SMILES | CC(C)(C)[C@@H](c1ccc(Cl)o1)N1CCNCC1 |
| InChI | InChI=1S/C13H21ClN2O/c1-13(2,3)12(10-4-5-11(14)17-10)16-8-6-15-7-9-16/h4-5,12,15H,6-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | YPXWUHXQFUJQJV-GFCCVEGCSA-N |
| XLogP | 2.93 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |