C11H16Cl3N3O — CID 171306353
(3S)-3-(5-chlorofuran-2-yl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306353) has the molecular formula C11H16Cl3N3O and a molecular weight of 312.63 g/mol. Its IUPAC name is (3S)-3-(5-chlorofuran-2-yl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3S)-3-(5-chlorofuran-2-yl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306353 |
| Molecular Formula | C11H16Cl3N3O |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | (3S)-3-(5-chlorofuran-2-yl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@@H](c1ccc(Cl)o1)N1CCNCC1 |
| InChI | InChI=1S/C11H14ClN3O.2ClH/c12-11-2-1-10(16-11)9(3-4-13)15-7-5-14-6-8-15;;/h1-2,9,14H,3,5-8H2;2*1H/t9-;;/m0../s1 |
| InChIKey | RDPYYNMWXLXZHK-WWPIYYJJSA-N |
| XLogP | 2.64 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |