C20H21ClF4N2O2 — CID 171283311
1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171283311) has the molecular formula C20H21ClF4N2O2 and a molecular weight of 432.85 g/mol. Its IUPAC name is 1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171283311 |
| Molecular Formula | C20H21ClF4N2O2 |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | CCOc1c(F)cc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C20H21ClF4N2O2/c1-2-28-19-16(21)11-14(12-17(19)22)18(27-9-7-26-8-10-27)13-3-5-15(6-4-13)29-20(23,24)25/h3-6,11-12,18,26H,2,7-10H2,1H3/t18-/m0/s1 |
| InChIKey | YPENYPAGQQNEKL-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |