C13H17BrF3N3 — CID 171302598
1-[(1S)-1-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171302598) has the molecular formula C13H17BrF3N3 and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-[(1S)-1-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1S)-1-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171302598 |
| Molecular Formula | C13H17BrF3N3 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-[(1S)-1-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | FC(F)(F)CC[C@@H](c1ccc(Br)nc1)N1CCNCC1 |
| InChI | InChI=1S/C13H17BrF3N3/c14-12-2-1-10(9-19-12)11(3-4-13(15,16)17)20-7-5-18-6-8-20/h1-2,9,11,18H,3-8H2/t11-/m0/s1 |
| InChIKey | KXTIBYYREXKEHO-NSHDSACASA-N |
| XLogP | 3.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|