C15H26BrCl2N3 — CID 171308984
1-[(1S)-1-(6-bromo-3-pyridinyl)hexyl]piperazine;dihydrochloride (PubChem CID 171308984) has the molecular formula C15H26BrCl2N3 and a molecular weight of 399.20 g/mol. Its IUPAC name is 1-[(1S)-1-(6-bromo-3-pyridinyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(6-bromo-3-pyridinyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308984 |
| Molecular Formula | C15H26BrCl2N3 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-[(1S)-1-(6-bromo-3-pyridinyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@@H](c1ccc(Br)nc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H24BrN3.2ClH/c1-2-3-4-5-14(19-10-8-17-9-11-19)13-6-7-15(16)18-12-13;;/h6-7,12,14,17H,2-5,8-11H2,1H3;2*1H/t14-;;/m0../s1 |
| InChIKey | SETCQDATPIAZOE-UTLKBRERSA-N |
| XLogP | 4.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|