C24H30FN5O4 — CID 171317038
(1R,2S,8S,9S)-11-(2-amino-5-methyl-1H-imidazole-4-carbonyl)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 171317038) has the molecular formula C24H30FN5O4 and a molecular weight of 471.53 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(2-amino-5-methyl-1H-imidazole-4-carbonyl)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8S,9S)-11-(2-amino-5-methyl-1H-imidazole-4-carbonyl)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 171317038 |
| Molecular Formula | C24H30FN5O4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (1R,2S,8S,9S)-11-(2-amino-5-methyl-1H-imidazole-4-carbonyl)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | Cc1[nH]c(N)nc1C(=O)N1C[C@H]2C[C@@H](C1)[C@H](Cc1cccc(F)c1)N1C(=O)CCC[C@@H]21.O=CO |
| InChI | InChI=1S/C23H28FN5O2.CH2O2/c1-13-21(27-23(25)26-13)22(31)28-11-15-10-16(12-28)19(9-14-4-2-5-17(24)8-14)29-18(15)6-3-7-20(29)30;2-1-3/h2,4-5,8,15-16,18-19H,3,6-7,9-12H2,1H3,(H3,25,26,27);1H,(H,2,3)/t15-,16+,18+,19+;/m1./s1 |
| InChIKey | IUOXHSBEPDYEFW-JNDCXILUSA-N |
| XLogP | 2.22 |
| TPSA | 132.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|