C24H26N4O5 — CID 171322563
[(3aS,6aR)-3a-(2-phenylethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-(1,2-oxazol-3-yl)methanone;formic acid (PubChem CID 171322563) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is [(3aS,6aR)-3a-(2-phenylethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-(1,2-oxazol-3-yl)methanone;formic acid.
| Compound Name | [(3aS,6aR)-3a-(2-phenylethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-(1,2-oxazol-3-yl)methanone;formic acid |
|---|---|
| PubChem CID | 171322563 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(3aS,6aR)-3a-(2-phenylethyl)-5-(1H-pyrrole-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-(1,2-oxazol-3-yl)methanone;formic acid |
| SMILES | O=C(c1ccon1)N1C[C@H]2CN(C(=O)c3ccc[nH]3)C[C@@]2(CCc2ccccc2)C1.O=CO |
| InChI | InChI=1S/C23H24N4O3.CH2O2/c28-21(19-7-4-11-24-19)26-13-18-14-27(22(29)20-9-12-30-25-20)16-23(18,15-26)10-8-17-5-2-1-3-6-17;2-1-3/h1-7,9,11-12,18,24H,8,10,13-16H2;1H,(H,2,3)/t18-,23+;/m1./s1 |
| InChIKey | GDMSORQAZQGCJO-IMIWJGOWSA-N |
| XLogP | 2.55 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|