C9H14N4 — CID 171326440
1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 171326440) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 171326440 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | Cn1ncnc1CN1CC=CCC1 |
| InChI | InChI=1S/C9H14N4/c1-12-9(10-8-11-12)7-13-5-3-2-4-6-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | IWPOEGWVKJLHRO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|