About 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine
4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine (PubChem CID 171328024) has the molecular formula C15H21N5S
and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine.
Molecular Properties
| Compound Name | 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine |
| PubChem CID | 171328024 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine |
| SMILES | c1cn2nccc2c(N2CCC(N3CCSCC3)CC2)n1 |
| InChI | InChI=1S/C15H21N5S/c1-4-17-20-8-5-16-15(14(1)20)19-6-2-13(3-7-19)18-9-11-21-12-10-18/h1,4-5,8,13H,2-3,6-7,9-12H2 |
| InChIKey | WPPNNPAKSNXKAW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine?
The IUPAC name of 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine (CID 171328024) is 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine.
What is the SMILES notation for 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine?
The canonical SMILES for 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine is c1cn2nccc2c(N2CCC(N3CCSCC3)CC2)n1.
What is the InChIKey of 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine?
The InChIKey is WPPNNPAKSNXKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5S/c1-4-17-20-8-5-16-15(14(1)20)19-6-2-13(3-7-19)18-9-11-21-12-10-18/h1,4-5,8,13H,2-3,6-7,9-12H2.
What are the key properties of 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine?
4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine has a molecular weight of 303.43 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-4-yl)thiomorpholine is sourced from PubChem (CID 171328024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).