C19H17ClF4N2O — CID 171336416
6-ethoxy-N-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)quinolin-4-amine;hydrochloride (PubChem CID 171336416) has the molecular formula C19H17ClF4N2O and a molecular weight of 400.80 g/mol. Its IUPAC name is 6-ethoxy-N-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)quinolin-4-amine;hydrochloride.
| Compound Name | 6-ethoxy-N-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)quinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 171336416 |
| Molecular Formula | C19H17ClF4N2O |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 6-ethoxy-N-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)quinolin-4-amine;hydrochloride |
| SMILES | CCOc1ccc2nc(C(F)(F)F)cc(Nc3ccc(C)c(F)c3)c2c1.Cl |
| InChI | InChI=1S/C19H16F4N2O.ClH/c1-3-26-13-6-7-16-14(9-13)17(10-18(25-16)19(21,22)23)24-12-5-4-11(2)15(20)8-12;/h4-10H,3H2,1-2H3,(H,24,25);1H |
| InChIKey | FPXXZUNTPWZOOR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |