C22H22N4O2 — CID 171336884
(1S,2S,3S,4R)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171336884) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171336884 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,2S,3S,4R)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C22H22N4O2/c27-21(24-13-14-5-4-10-23-12-14)18-16-8-9-17(11-16)19(18)22-25-20(26-28-22)15-6-2-1-3-7-15/h1-7,10,12,16-19H,8-9,11,13H2,(H,24,27)/t16-,17+,18-,19-/m0/s1 |
| InChIKey | LAKYWUUBHZFQRJ-RDGPPVDQSA-N |
| XLogP | 3.58 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |