C23H24N4O3 — CID 171336851
(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171336851) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171336851 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-N-(pyridin-3-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(COc2ccccc2)no1 |
| InChI | InChI=1S/C23H24N4O3/c28-22(25-13-15-5-4-10-24-12-15)20-16-8-9-17(11-16)21(20)23-26-19(27-30-23)14-29-18-6-2-1-3-7-18/h1-7,10,12,16-17,20-21H,8-9,11,13-14H2,(H,25,28)/t16-,17+,20-,21-/m0/s1 |
| InChIKey | HEEKTMQRLKRHIL-JWWGGVBKSA-N |
| XLogP | 3.49 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |