C22H27N3O3 — CID 171336847
(1S,2S,3S,4R)-N-cyclopentyl-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171336847) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (1S,2S,3S,4R)-N-cyclopentyl-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-N-cyclopentyl-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171336847 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1S,2S,3S,4R)-N-cyclopentyl-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(COc2ccccc2)no1 |
| InChI | InChI=1S/C22H27N3O3/c26-21(23-16-6-4-5-7-16)19-14-10-11-15(12-14)20(19)22-24-18(25-28-22)13-27-17-8-2-1-3-9-17/h1-3,8-9,14-16,19-20H,4-7,10-13H2,(H,23,26)/t14-,15+,19-,20-/m0/s1 |
| InChIKey | UJTJSCFWQMDGTR-VZJWBNGJSA-N |
| XLogP | 3.84 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |