C21H25N3O4 — CID 171336833
(3-methoxyazetidin-1-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 171336833) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3-methoxyazetidin-1-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | (3-methoxyazetidin-1-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 171336833 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3-methoxyazetidin-1-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | COC1CN(C(=O)[C@H]2[C@H]3CC[C@H](C3)[C@@H]2c2nc(COc3ccccc3)no2)C1 |
| InChI | InChI=1S/C21H25N3O4/c1-26-16-10-24(11-16)21(25)19-14-8-7-13(9-14)18(19)20-22-17(23-28-20)12-27-15-5-3-2-4-6-15/h2-6,13-14,16,18-19H,7-12H2,1H3/t13-,14+,18+,19+/m1/s1 |
| InChIKey | XQFZGLRTSZLWMX-WXRFYESLSA-N |
| XLogP | 2.64 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |