C24H24ClN3O2 — CID 171337048
(1S,2S,3S,4R)-N-[(4-chlorophenyl)methyl]-3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171337048) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is (1S,2S,3S,4R)-N-[(4-chlorophenyl)methyl]-3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-N-[(4-chlorophenyl)methyl]-3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171337048 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (1S,2S,3S,4R)-N-[(4-chlorophenyl)methyl]-3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1cccc(-c2noc([C@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C(=O)NCc3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C24H24ClN3O2/c1-14-3-2-4-18(11-14)22-27-24(30-28-22)21-17-8-7-16(12-17)20(21)23(29)26-13-15-5-9-19(25)10-6-15/h2-6,9-11,16-17,20-21H,7-8,12-13H2,1H3,(H,26,29)/t16-,17+,20-,21-/m0/s1 |
| InChIKey | ZZTBZGIRLRKOIZ-JWWGGVBKSA-N |
| XLogP | 5.14 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |